Difference between revisions of "PWY-7840"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] == * common-name: ** a reduced glutaredoxin == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * common-name: ** 5-methyl-3-oxo-4-hexenoyl-coa * smiles: ** cc(c)=cc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
 
* common-name:
 
* common-name:
** a reduced glutaredoxin
+
** 5-methyl-3-oxo-4-hexenoyl-coa
 +
* smiles:
 +
** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** zfkzvsujtdsjey-svhodsnwsa-j
 +
* molecular-weight:
 +
** 887.641
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-982]]
+
* [[RXN-11921]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced glutaredoxin}}
+
{{#set: common-name=5-methyl-3-oxo-4-hexenoyl-coa}}
 +
{{#set: inchi-key=inchikey=zfkzvsujtdsjey-svhodsnwsa-j}}
 +
{{#set: molecular-weight=887.641}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-12906

  • common-name:
    • 5-methyl-3-oxo-4-hexenoyl-coa
  • smiles:
    • cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zfkzvsujtdsjey-svhodsnwsa-j
  • molecular-weight:
    • 887.641

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality