Difference between revisions of "PWY-5486"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO PRO] ==
 * common-name:
-** (2s)-liquiritigenin
+** l-proline
 * smiles:
-** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
+** c1([n+]c(cc1)c(=o)[o-])
 * inchi-key:
-** furuxtvzlhccna-aweznqclsa-n
+** onibwkktopovia-bypyzucnsa-n
 * molecular-weight:
-** 256.257
+** 115.132
 == Reaction(s) known to consume the compound ==
+* [[PROLINE--TRNA-LIGASE-RXN]]
+* [[RXN-14903]]
+* [[RXN0-7008]]
+* [[RXN490-3641]]
+* [[RXN66-542]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-3221]]
+* [[3.4.11.5-RXN]]
+* [[3.4.13.9-RXN]]
+* [[ORNITHINE-CYCLODEAMINASE-RXN]]
+* [[PYRROLINECARBREDUCT-RXN]]
+* [[RXN0-6988]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2s)-liquiritigenin}}
+{{#set: common-name=l-proline}}
-{{#set: inchi-key=inchikey=furuxtvzlhccna-aweznqclsa-n}}
+{{#set: inchi-key=inchikey=onibwkktopovia-bypyzucnsa-n}}
-{{#set: molecular-weight=256.257}}
+{{#set: molecular-weight=115.132}}