Difference between revisions of "PWY-4361"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VERY-LONG-CHAIN-FATTY-ACYL-COA VERY-LONG-CHAIN-FATTY-ACYL-COA] ==
 * common-name:
-** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
+** a very long chain fatty acyl-coa
-* smiles:
-** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
-* inchi-key:
-** lieylsgxgoxytd-ctbyciiysa-m
-* molecular-weight:
-** 629.941
 == Reaction(s) known to consume the compound ==
-* [[RXN-9287]]
+* [[RXN3O-328]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-16415]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
+{{#set: common-name=a very long chain fatty acyl-coa}}
-{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
-{{#set: molecular-weight=629.941}}