Difference between revisions of "PWY-7762"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Digalactosylceramide-sulfate Digalactosylceramide-sulfate] == * common-name: ** a digalactosylc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] == * common-name: ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Digalactosylceramide-sulfate Digalactosylceramide-sulfate] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] ==
 
* common-name:
 
* common-name:
** a digalactosylceramide sulfate
+
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
 +
* smiles:
 +
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
 +
* inchi-key:
 +
** lieylsgxgoxytd-ctbyciiysa-m
 +
* molecular-weight:
 +
** 629.941
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9287]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18303]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a digalactosylceramide sulfate}}
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
 +
{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
 +
{{#set: molecular-weight=629.941}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-9903

  • common-name:
    • 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
  • inchi-key:
    • lieylsgxgoxytd-ctbyciiysa-m
  • molecular-weight:
    • 629.941

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality