Difference between revisions of "PWY-7943"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=34-Dihydroxy-5-Polyprenylbenzoates 34-Dihydroxy-5-Polyprenylbenzoates] == * common-name: ** a 3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=34-Dihydroxy-5-Polyprenylbenzoates 34-Dihydroxy-5-Polyprenylbenzoates] ==
 
* common-name:
 
* common-name:
** α-d-glucuronate 1-phosphate
+
** a 3,4-dihydroxy-5-all-trans-polyprenylbenzoate
* smiles:
 
** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
 
* inchi-key:
 
** aiqdykmwenwvqj-qiuujyrfsa-k
 
* molecular-weight:
 
** 271.097
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.44-RXN]]
+
* [[RXN-11757]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.44-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-glucuronate 1-phosphate}}
+
{{#set: common-name=a 3,4-dihydroxy-5-all-trans-polyprenylbenzoate}}
{{#set: inchi-key=inchikey=aiqdykmwenwvqj-qiuujyrfsa-k}}
 
{{#set: molecular-weight=271.097}}
 

Revision as of 09:22, 27 August 2019

Metabolite 34-Dihydroxy-5-Polyprenylbenzoates

  • common-name:
    • a 3,4-dihydroxy-5-all-trans-polyprenylbenzoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality