Difference between revisions of "PWYQT-4427"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * common-name: ** 1d-myo-inositol 6-monophosphate * smiles: ** c1(o)(c(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-5-enoyl-CoA cis-5-enoyl-CoA] == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-5-enoyl-CoA cis-5-enoyl-CoA] ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 6-monophosphate
+
** a (5z)-alkan-5-enoyl-coa
* smiles:
 
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
 
* inchi-key:
 
** inapmgsxuvuwaf-xcmzkkersa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10954]]
+
* [[RXN-12518]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 6-monophosphate}}
+
{{#set: common-name=a (5z)-alkan-5-enoyl-coa}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-xcmzkkersa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 09:22, 27 August 2019

Metabolite cis-5-enoyl-CoA

  • common-name:
    • a (5z)-alkan-5-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality