Difference between revisions of "PWY-7492"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=24-26-N-linked-Glycan 24-26-N-linked-Glycan] == * common-name: ** a {β-d-glcnac-(1→2)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5923 CPD-5923] == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5923 CPD-5923] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-deoxy-5'-fluoroadenosine |
| + | * smiles: | ||
| + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f | ||
| + | * inchi-key: | ||
| + | ** qpvlkmicbyrpsx-kqynxxcusa-n | ||
| + | * molecular-weight: | ||
| + | ** 269.235 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11743]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-deoxy-5'-fluoroadenosine}} |
| + | {{#set: inchi-key=inchikey=qpvlkmicbyrpsx-kqynxxcusa-n}} | ||
| + | {{#set: molecular-weight=269.235}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-5923
- common-name:
- 5'-deoxy-5'-fluoroadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f
- inchi-key:
- qpvlkmicbyrpsx-kqynxxcusa-n
- molecular-weight:
- 269.235
