Difference between revisions of "ARGSYNBSUB-PWY"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] ==
 * common-name:
-** 15,16-dihydrobiliverdin
+** dgmp
 * smiles:
-** c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o)[o-])=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 * inchi-key:
-** zqhdslzhmauuqk-ztygkhtcsa-l
+** ltfmzdnnppeqng-kvqbguixsa-l
 * molecular-weight:
-** 582.655
+** 345.208
 == Reaction(s) known to consume the compound ==
-* [[1.3.7.3-RXN]]
+* [[ATDGM]]
-* [[R05818]]
+* [[DMPH]]
-* [[R05819]]
 == Reaction(s) known to produce the compound ==
-* [[1.3.7.2-RXN]]
+* [[DGTD]]
-* [[R05818]]
+* [[DMPH]]
-* [[R05819]]
+* [[RXN-14208]]
+* [[RXN-14218]]
+* [[RXN0-385]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=15,16-dihydrobiliverdin}}
+{{#set: common-name=dgmp}}
-{{#set: inchi-key=inchikey=zqhdslzhmauuqk-ztygkhtcsa-l}}
+{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}
-{{#set: molecular-weight=582.655}}
+{{#set: molecular-weight=345.208}}