Difference between revisions of "PWY-4041"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ppp-Pur-mRNA 5-ppp-Pur-mRNA] == * common-name: ** a 5'-triphospho-purine-[mrna] == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ppp-Pur-mRNA 5-ppp-Pur-mRNA] ==
 
* common-name:
 
* common-name:
** β-d-ribosylnicotinate
+
** a 5'-triphospho-purine-[mrna]
* smiles:
 
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
 
* inchi-key:
 
** pueddpcucprqny-zyuzmqfosa-n
 
* molecular-weight:
 
** 255.227
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14227]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-ribosylnicotinate}}
+
{{#set: common-name=a 5'-triphospho-purine-[mrna]}}
{{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}}
 
{{#set: molecular-weight=255.227}}
 

Revision as of 09:22, 27 August 2019

Metabolite 5-ppp-Pur-mRNA

  • common-name:
    • a 5'-triphospho-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-triphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.