Difference between revisions of "PWY-6470"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYPHENYLGLYCOLALDEHYDE DIHYDROXYPHENYLGLYCOLALDEHYDE] == * common-name: ** 3,4-dihydroxy...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ditrans-polycis-polyprenols Ditrans-polycis-polyprenols] == * common-name: ** a di-trans, poly-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYPHENYLGLYCOLALDEHYDE DIHYDROXYPHENYLGLYCOLALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ditrans-polycis-polyprenols Ditrans-polycis-polyprenols] ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxyphenylglycolaldehyde
+
** a di-trans, poly-cis-polyprenol
* smiles:
 
** c(=o)c(o)c1(c=cc(o)=c(o)c=1)
 
* inchi-key:
 
** yugmcljiwgekck-qmmmgpobsa-n
 
* molecular-weight:
 
** 168.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10911]]
+
* [[RXN-9971]]
* [[RXN-10912]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10907]]
 
* [[RXN-10908]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}}
+
{{#set: common-name=a di-trans, poly-cis-polyprenol}}
{{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}}
 
{{#set: molecular-weight=168.149}}
 

Revision as of 09:22, 27 August 2019

Metabolite Ditrans-polycis-polyprenols

  • common-name:
    • a di-trans, poly-cis-polyprenol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality