Difference between revisions of "PWY-481"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-2-acyl-glycerol 1-Alkyl-2-acyl-glycerol] == * common-name: ** a 2-acyl-1-alkyl-sn-glyce...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * common-name: ** d-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-2-acyl-glycerol 1-Alkyl-2-acyl-glycerol] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] ==
 
* common-name:
 
* common-name:
** a 2-acyl-1-alkyl-sn-glycerol
+
** d-glutamate
 +
* smiles:
 +
** c(ccc(c(=o)[o-])[n+])([o-])=o
 +
* inchi-key:
 +
** whuutdbjxjrkmk-gsvougtgsa-m
 +
* molecular-weight:
 +
** 146.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17731]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
* [[RXN-17733]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17730]]
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-acyl-1-alkyl-sn-glycerol}}
+
{{#set: common-name=d-glutamate}}
 +
{{#set: inchi-key=inchikey=whuutdbjxjrkmk-gsvougtgsa-m}}
 +
{{#set: molecular-weight=146.122}}

Revision as of 09:22, 27 August 2019

Metabolite D-GLT

  • common-name:
    • d-glutamate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])([o-])=o
  • inchi-key:
    • whuutdbjxjrkmk-gsvougtgsa-m
  • molecular-weight:
    • 146.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality