Difference between revisions of "PWY-8238"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] == * common-name: ** sitosterol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == |
* common-name: | * common-name: | ||
| − | ** | + | ** isoliquiritigenin |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dxdrhhkmwqzjht-fpygclrlsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.257 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-3221]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-3142]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=isoliquiritigenin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dxdrhhkmwqzjht-fpygclrlsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.257}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-3041
- common-name:
- isoliquiritigenin
- smiles:
- c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
- inchi-key:
- dxdrhhkmwqzjht-fpygclrlsa-n
- molecular-weight:
- 256.257
