Difference between revisions of "PWY-7285"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to cons...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == |
* common-name: | * common-name: | ||
− | ** | + | ** protoporphyrin ix |
+ | * smiles: | ||
+ | ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5))) | ||
+ | * inchi-key: | ||
+ | ** ksfovussgskxfi-ujjxfscmsa-l | ||
+ | * molecular-weight: | ||
+ | ** 560.651 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[PROTOHEMEFERROCHELAT-RXN]] |
+ | * [[RXN1F-20]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[PPPGO]] |
+ | * [[PROTOHEMEFERROCHELAT-RXN]] | ||
+ | * [[PROTOPORGENOXI-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=protoporphyrin ix}} |
+ | {{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}} | ||
+ | {{#set: molecular-weight=560.651}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite PROTOPORPHYRIN_IX
- common-name:
- protoporphyrin ix
- smiles:
- c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
- inchi-key:
- ksfovussgskxfi-ujjxfscmsa-l
- molecular-weight:
- 560.651