Difference between revisions of "PWY-7949"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-O-MeGuan-34-tRNAs 2-O-MeGuan-34-tRNAs] == * common-name: ** a 2'-o-methylguanosine34 in trna...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-O-MeGuan-34-tRNAs 2-O-MeGuan-34-tRNAs] ==
 
* common-name:
 
* common-name:
−
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
+
** a 2'-o-methylguanosine34 in trna
−
* smiles:
 
−
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 
−
* inchi-key:
 
−
** bujztfindcqrgp-zdlrkiohsa-l
 
−
* molecular-weight:
 
−
** 457.362
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16512]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16512]]
+
* [[RXN-11868]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}}
+
{{#set: common-name=a 2'-o-methylguanosine34 in trna}}
−
{{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}}
 
−
{{#set: molecular-weight=457.362}}
 

Revision as of 09:22, 27 August 2019

Metabolite 2-O-MeGuan-34-tRNAs

  • common-name:
    • a 2'-o-methylguanosine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-7949&oldid=27246"