Difference between revisions of "PWY-6613"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoyl-proteins Palmitoyl-proteins] == * common-name: ** a palmitoylated protein == Reaction...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] == * common-name: ** γ-linolenoyl-coa * smiles...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-linolenoyl-coa |
+ | * smiles: | ||
+ | ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** xzqyptbyqyzgru-fhdveodpsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1023.921 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12777]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.14.19.3-RXN]] | ||
+ | * [[RXN-16043]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-linolenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}} | ||
+ | {{#set: molecular-weight=1023.921}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite GAMMA-LINOLENOYL-COA
- common-name:
- γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xzqyptbyqyzgru-fhdveodpsa-j
- molecular-weight:
- 1023.921