Difference between revisions of "SJ08247"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] == * common-name: ** l-alanyl-glycine * smiles: ** cc([n+])c(ncc([o-])=o)=o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] ==
 
* common-name:
 
* common-name:
** 3-[(5'-methylthio)pentyl]malate
+
** l-alanyl-glycine
 
* smiles:
 
* smiles:
** cscccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** cc([n+])c(ncc([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** ybisuhxejdgadq-uhfffaoysa-l
+
** cxispyvymqwfle-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 248.293
+
** 146.146
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18204]]
+
* [[RXN0-6977]]
* [[RXNQT-4171]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18204]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(5'-methylthio)pentyl]malate}}
+
{{#set: common-name=l-alanyl-glycine}}
{{#set: inchi-key=inchikey=ybisuhxejdgadq-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=cxispyvymqwfle-vkhmyheasa-n}}
{{#set: molecular-weight=248.293}}
+
{{#set: molecular-weight=146.146}}

Revision as of 09:23, 27 August 2019

Metabolite ALA-GLY

  • common-name:
    • l-alanyl-glycine
  • smiles:
    • cc([n+])c(ncc([o-])=o)=o
  • inchi-key:
    • cxispyvymqwfle-vkhmyheasa-n
  • molecular-weight:
    • 146.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality