Difference between revisions of "SJ17257"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * common-name: ** pristanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=yW-72 yW-72] == * common-name: ** 7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=yW-72 yW-72] ==
 
* common-name:
 
* common-name:
** pristanoyl-coa
+
** 7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xyjpsqpvcbnzht-tukysrjdsa-j
 
* molecular-weight:
 
** 1043.995
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14528]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-484]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pristanoyl-coa}}
+
{{#set: common-name=7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=xyjpsqpvcbnzht-tukysrjdsa-j}}
 
{{#set: molecular-weight=1043.995}}
 

Revision as of 09:23, 27 August 2019

Metabolite yW-72

  • common-name:
    • 7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.