Difference between revisions of "SJ19466"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Prime-Ribonucleoside-Monophosphates 2-Prime-Ribonucleoside-Monophosphates] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Prime-Ribonucleoside-Monophosphates 2-Prime-Ribonucleoside-Monophosphates] ==
 
* common-name:
 
* common-name:
** l-selenocystathionine
+
** a ribonucleoside 2'-phosphate
* smiles:
 
** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
 
* inchi-key:
 
** znwydqpouqrdly-whfbiakzsa-n
 
* molecular-weight:
 
** 269.159
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12729]]
+
* [[RXN-17948]]
* [[RXN-15137]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACHMSSELCYSL]]
+
* [[3.1.4.37-RXN]]
* [[ACHMSSELCYSLh]]
 
* [[RXN-12728]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-selenocystathionine}}
+
{{#set: common-name=a ribonucleoside 2'-phosphate}}
{{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}}
 
{{#set: molecular-weight=269.159}}
 

Revision as of 09:23, 27 August 2019

Metabolite 2-Prime-Ribonucleoside-Monophosphates

  • common-name:
    • a ribonucleoside 2'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality