Difference between revisions of "SJ02165"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * common-name: ** l-selenocysteine * smiles: ** c([se])c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] ==
 
* common-name:
 
* common-name:
** 2-methyl-6-phytyl-1,4-benzoquinol
+
** l-selenocysteine
 
* smiles:
 
* smiles:
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
+
** c([se])c([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** gtwcnyrfozkwtl-uofxaseasa-n
+
** zkzbpngneqajsx-reohclbhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 402.659
+
** 168.054
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2542]]
+
* [[ACHMSSELCYSL]]
 +
* [[ACHMSSELCYSLh]]
 +
* [[RXN-12728]]
 +
* [[SELENOCYSTEINE-LYASE-RXN]]
 +
* [[SUCHMSSELCYSL]]
 +
* [[SUCHMSSELCYSLh]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2541]]
+
* [[RXN-12726]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}}
+
{{#set: common-name=l-selenocysteine}}
{{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}}
+
{{#set: inchi-key=inchikey=zkzbpngneqajsx-reohclbhsa-n}}
{{#set: molecular-weight=402.659}}
+
{{#set: molecular-weight=168.054}}

Revision as of 09:23, 27 August 2019

Metabolite L-SELENOCYSTEINE

  • common-name:
    • l-selenocysteine
  • smiles:
    • c([se])c([n+])c([o-])=o
  • inchi-key:
    • zkzbpngneqajsx-reohclbhsa-n
  • molecular-weight:
    • 168.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality