Difference between revisions of "SJ17329"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)scc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphotyrosine MAP-Kinase-L-Phosphotyrosine] == * common-name: ** a [mitogen-acti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphotyrosine MAP-Kinase-L-Phosphotyrosine] ==
 
* common-name:
 
* common-name:
** 4-cis-undecenoyl-coa
+
** a [mitogen-activated protein kinase] l-tyrosine phosphate
* smiles:
 
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** afmmiiqkxqnedn-nsdzghcesa-j
 
* molecular-weight:
 
** 929.765
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14775]]
+
* [[RXN-16317]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14774]]
+
* [[RXN-16317]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-cis-undecenoyl-coa}}
+
{{#set: common-name=a [mitogen-activated protein kinase] l-tyrosine phosphate}}
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}}
 
{{#set: molecular-weight=929.765}}
 

Revision as of 09:23, 27 August 2019

Metabolite MAP-Kinase-L-Phosphotyrosine

  • common-name:
    • a [mitogen-activated protein kinase] l-tyrosine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [mitogen-activated protein kinase] l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.