Difference between revisions of "SJ18177"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * common-name: ** 3-methylcrotonyl-coa * smiles...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** dump
 
* smiles:
 
* smiles:
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** bxipalatiynhjn-zmhdxicwsa-j
+
** jsrljpsbldheio-shyzeuofsa-l
 
* molecular-weight:
 
* molecular-weight:
** 845.604
+
** 306.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[MDUMT]]
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
* [[RXN-14143]]
* [[RXN-14264]]
+
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[DCMP-DEAMINASE-RXN]]
* [[IVCDH]]
+
* [[DUTNH]]
* [[RXN-11921]]
+
* [[DUTP-PYROP-RXN]]
* [[RXN-14264]]
+
* [[MDUMT]]
* [[RXN0-2301]]
+
* [[RXN-14199]]
 +
* [[RXN-14220]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=dump}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
{{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}}
{{#set: molecular-weight=845.604}}
+
{{#set: molecular-weight=306.168}}

Revision as of 09:23, 27 August 2019

Metabolite DUMP

  • common-name:
    • dump
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • jsrljpsbldheio-shyzeuofsa-l
  • molecular-weight:
    • 306.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality