Difference between revisions of "SJ14159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * common-name: ** theobromine * smiles: ** cn2(c=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-cysteinyl-Protein L-methionyl-L-cysteinyl-Protein] == * common-name: ** an n-term...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-cysteinyl-Protein L-methionyl-L-cysteinyl-Protein] ==
 
* common-name:
 
* common-name:
** theobromine
+
** an n-terminal-l-methionyl-l-cysteinyl-[protein]
* smiles:
 
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 
* inchi-key:
 
** yapqbxqyljrxsa-uhfffaoysa-n
 
* molecular-weight:
 
** 180.166
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11519]]
+
* [[RXN-17874]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=theobromine}}
+
{{#set: common-name=an n-terminal-l-methionyl-l-cysteinyl-[protein]}}
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}
 
{{#set: molecular-weight=180.166}}
 

Revision as of 09:23, 27 August 2019

Metabolite L-methionyl-L-cysteinyl-Protein

  • common-name:
    • an n-terminal-l-methionyl-l-cysteinyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal-l-methionyl-l-cysteinyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.