Difference between revisions of "SJ05429"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARABITOL L-ARABITOL] == * common-name: ** l-arabinitol * smiles: ** c(c(c(c(co)o)o)o)o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARABITOL L-ARABITOL] ==
 
* common-name:
 
* common-name:
** dimethylallyl diphosphate
+
** l-arabinitol
 
* smiles:
 
* smiles:
** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** c(c(c(c(co)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** cbidrcwhncksto-uhfffaoysa-k
+
** hebkchpvoiaqta-imjsidkusa-n
 
* molecular-weight:
 
* molecular-weight:
** 243.069
+
** 152.147
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GPPS]]
+
* [[RXN-14102]]
* [[GPPSYN-RXN]]
+
* [[RXN-8772]]
* [[IPPISOM-RXN]]
 
* [[RXN-4303]]
 
* [[RXN-4305]]
 
* [[RXN-4307]]
 
* [[RXN-7810]]
 
* [[RXN-7811]]
 
* [[RXN-7813]]
 
* [[RXN0-6274]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GPPSYN-RXN]]
+
* [[RXN-14102]]
* [[IDI]]
+
* [[RXN-8772]]
* [[IDS2]]
 
* [[IPPISOM-RXN]]
 
* [[RXN0-884]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dimethylallyl diphosphate}}
+
{{#set: common-name=l-arabinitol}}
{{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=hebkchpvoiaqta-imjsidkusa-n}}
{{#set: molecular-weight=243.069}}
+
{{#set: molecular-weight=152.147}}

Revision as of 09:23, 27 August 2019

Metabolite L-ARABITOL

  • common-name:
    • l-arabinitol
  • smiles:
    • c(c(c(c(co)o)o)o)o
  • inchi-key:
    • hebkchpvoiaqta-imjsidkusa-n
  • molecular-weight:
    • 152.147

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality