Difference between revisions of "SJ13891"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * common-name: ** 4-hydroxy-2-nonenal * smiles: ** cccccc(o)[ch]=cc=o *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-dihydroorotate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufivepvsagbusi-reohclbhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 157.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DIHYDROOROT-RXN]] |
| + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | ||
| + | * [[RXN0-6491]] | ||
| + | * [[RXN0-6554]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DIHYDROOROT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-dihydroorotate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=157.105}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite DI-H-OROTATE
- common-name:
- (s)-dihydroorotate
- smiles:
- c1(c(=o)nc(=o)nc(c(=o)[o-])1)
- inchi-key:
- ufivepvsagbusi-reohclbhsa-m
- molecular-weight:
- 157.105
