Difference between revisions of "SJ00413"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * common-name: ** 5α-cholesta-8-en-3-one * smiles: ** cc(c)cccc([ch...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == * common-name: ** udp-α-d-galacturonate * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] ==
 
* common-name:
 
* common-name:
** 5α-cholesta-8-en-3-one
+
** udp-α-d-galacturonate
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(=o)cc3)))cc4)))c
+
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
 
* inchi-key:
 
* inchi-key:
** rzsxshnnqbiptl-zsbatxslsa-n
+
** hdyanyhvcapmjv-gxnrkqdosa-k
 
* molecular-weight:
 
* molecular-weight:
** 384.644
+
** 577.265
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-24]]
+
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-23]]
+
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5α-cholesta-8-en-3-one}}
+
{{#set: common-name=udp-α-d-galacturonate}}
{{#set: inchi-key=inchikey=rzsxshnnqbiptl-zsbatxslsa-n}}
+
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-gxnrkqdosa-k}}
{{#set: molecular-weight=384.644}}
+
{{#set: molecular-weight=577.265}}

Revision as of 09:23, 27 August 2019

Metabolite UDP-D-GALACTURONATE

  • common-name:
    • udp-α-d-galacturonate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
  • inchi-key:
    • hdyanyhvcapmjv-gxnrkqdosa-k
  • molecular-weight:
    • 577.265

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality