Difference between revisions of "SJ01805"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine N-terminal-L-cysteine] == * common-name: ** an n-terminal l-cysteinyl-[pr...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8092 CPD-8092] == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8092 CPD-8092] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine |
| + | * smiles: | ||
| + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o | ||
| + | * inchi-key: | ||
| + | ** fvqgnfubhwgfcy-hjoyqdmmsa-n | ||
| + | * molecular-weight: | ||
| + | ** 782.092 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8324]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8326]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}} |
| + | {{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}} | ||
| + | {{#set: molecular-weight=782.092}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-8092
- common-name:
- 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- fvqgnfubhwgfcy-hjoyqdmmsa-n
- molecular-weight:
- 782.092
