Difference between revisions of "SJ13053"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] == * common-name: ** udp-4-ami...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] ==
 
* common-name:
 
* common-name:
** udp-4-amino-4-deoxy-β-l-arabinopyranose
+
** cis-aconitate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
+
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** gwbakybswhqnmq-iazovdbxsa-m
+
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* molecular-weight:
 
* molecular-weight:
** 534.286
+
** 171.086
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1863]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1863]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}}
+
{{#set: common-name=cis-aconitate}}
{{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}}
+
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
{{#set: molecular-weight=534.286}}
+
{{#set: molecular-weight=171.086}}

Revision as of 09:23, 27 August 2019

Metabolite CIS-ACONITATE

  • common-name:
    • cis-aconitate
  • smiles:
    • c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • gtzcvfvgugfeme-iwqzzhsrsa-k
  • molecular-weight:
    • 171.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality