Difference between revisions of "SJ16038"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG0 HG0] == * common-name: ** hg0 * smiles: ** [hg] * inchi-key: ** qshddoujbyecft-uhfffaoysa-n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gfjkjlhwwzxdau-kxfgnqbasa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 450.508 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16118]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16117]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=450.508}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-17372
- common-name:
- 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
- smiles:
- c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- gfjkjlhwwzxdau-kxfgnqbasa-l
- molecular-weight:
- 450.508
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoleyl]-2-lyso-phosphatidate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
