Difference between revisions of "SJ15522"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Methylcytosine-DNA 5-Methylcytosine-DNA] ==
 * common-name:
-** pelargonidin-3-o-&beta;-d-glucoside
+** a 5-methylcytosine in dna
-* smiles:
-** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
-* inchi-key:
-** abvcubuixwjyse-gqupqbgvsa-m
-* molecular-weight:
-** 431.375
 == Reaction(s) known to consume the compound ==
-* [[RXN-7828]]
 == Reaction(s) known to produce the compound ==
+* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=pelargonidin-3-o-&beta;-d-glucoside}}
+{{#set: common-name=a 5-methylcytosine in dna}}
-{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
-{{#set: molecular-weight=431.375}}