Difference between revisions of "SJ04694"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * common-name: ** n-formylkynurenine * smiles: ** [ch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-isobutanoyl-coa
+
** n-formylkynurenine
 
* smiles:
 
* smiles:
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
+
** [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** wweogfzefhpuam-uqcjfraesa-j
+
** byhjhxptqmmkca-qmmmgpobsa-n
 
* molecular-weight:
 
* molecular-weight:
** 849.593
+
** 236.227
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
+
* [[ARYLFORMAMIDASE-RXN]]
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
* [[RXN-8665]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
+
{{#set: common-name=n-formylkynurenine}}
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
+
{{#set: inchi-key=inchikey=byhjhxptqmmkca-qmmmgpobsa-n}}
{{#set: molecular-weight=849.593}}
+
{{#set: molecular-weight=236.227}}

Revision as of 09:23, 27 August 2019

Metabolite N-FORMYLKYNURENINE

  • common-name:
    • n-formylkynurenine
  • smiles:
    • [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-])
  • inchi-key:
    • byhjhxptqmmkca-qmmmgpobsa-n
  • molecular-weight:
    • 236.227

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality