Difference between revisions of "SJ18572"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * common-name: ** l-dehydro-ascorbate * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * common-name: ** nicotine-1'-n-oxide * smiles: ** c1(cc[ch](n(=o)(c)1)c2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
 
* common-name:
 
* common-name:
** l-dehydro-ascorbate
+
** nicotine-1'-n-oxide
 
* smiles:
 
* smiles:
** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
+
** c1(cc[ch](n(=o)(c)1)c2(=cn=cc=c2))
 
* inchi-key:
 
* inchi-key:
** sbjkkffyizucet-szscbosdsa-n
+
** rwfbqhicrcuqjj-nuhjpdehsa-n
 
* molecular-weight:
 
* molecular-weight:
** 174.11
+
** 178.233
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.5.1-RXN]]
 
* [[RXN-13185]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[RXN66-81]]
* [[ETHYL-RXN]]
 
* [[RXN-12440]]
 
* [[RXN-13185]]
 
* [[RXN-19200]]
 
* [[RXN-7984]]
 
* [[RXN-7985]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dehydro-ascorbate}}
+
{{#set: common-name=nicotine-1'-n-oxide}}
{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
+
{{#set: inchi-key=inchikey=rwfbqhicrcuqjj-nuhjpdehsa-n}}
{{#set: molecular-weight=174.11}}
+
{{#set: molecular-weight=178.233}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-2743

  • common-name:
    • nicotine-1'-n-oxide
  • smiles:
    • c1(cc[ch](n(=o)(c)1)c2(=cn=cc=c2))
  • inchi-key:
    • rwfbqhicrcuqjj-nuhjpdehsa-n
  • molecular-weight:
    • 178.233

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality