Difference between revisions of "SJ16373"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-Chain-234-Saturated-acyl-CoAs Short-Chain-234-Saturated-acyl-CoAs] ==
 * common-name:
-** caldariellaquinol
+** a short-chain 2,3,4-saturated fatty acyl coa
-* smiles:
-** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
-* inchi-key:
-** uvcqokdzgiahdg-uhfffaoysa-n
-* molecular-weight:
-** 633.085
 == Reaction(s) known to consume the compound ==
+* [[RXN-13449]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-15378]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=caldariellaquinol}}
+{{#set: common-name=a short-chain 2,3,4-saturated fatty acyl coa}}
-{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
-{{#set: molecular-weight=633.085}}