Difference between revisions of "SJ02523"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17540 CPD-17540] == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == * common-name: ** secologanin * smiles: ** c=c[ch]1(c(oc=c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17540 CPD-17540] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] ==
 
* common-name:
 
* common-name:
** dapdiamide b
+
** secologanin
 
* smiles:
 
* smiles:
** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
+
** c=c[ch]1(c(oc=c(c(=o)oc)[ch](cc=o)1)oc2(oc(co)c(o)c(o)c(o)2))
 
* inchi-key:
 
* inchi-key:
** wsfqksibzodgpb-ofaneystsa-n
+
** cskkdsfetglmsb-nrzpkykesa-n
 
* molecular-weight:
 
* molecular-weight:
** 314.341
+
** 388.371
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[STRICTOSIDINE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16292]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dapdiamide b}}
+
{{#set: common-name=secologanin}}
{{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}}
+
{{#set: inchi-key=inchikey=cskkdsfetglmsb-nrzpkykesa-n}}
{{#set: molecular-weight=314.341}}
+
{{#set: molecular-weight=388.371}}

Revision as of 09:23, 27 August 2019

Metabolite SECOLOGANIN-CPD

  • common-name:
    • secologanin
  • smiles:
    • c=c[ch]1(c(oc=c(c(=o)oc)[ch](cc=o)1)oc2(oc(co)c(o)c(o)c(o)2))
  • inchi-key:
    • cskkdsfetglmsb-nrzpkykesa-n
  • molecular-weight:
    • 388.371

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality