Difference between revisions of "SJ02440"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] == * common-name: ** pelargonidin-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] ==
 
* common-name:
 
* common-name:
** (2e)-dodec-2-enoyl-coa
+
** pelargonidin-3-o-β-d-glucoside
 
* smiles:
 
* smiles:
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
 
* inchi-key:
 
* inchi-key:
** irfyvbulxzmede-xcfippspsa-j
+
** abvcubuixwjyse-gqupqbgvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 943.792
+
** 431.375
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH5]]
+
* [[RXN-7828]]
* [[ECOAH5h]]
 
* [[ECOAH5m]]
 
* [[RXN-14262]]
 
* [[RXN-7931]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA120OR]]
 
* [[ECOAH5]]
 
* [[ECOAH5h]]
 
* [[ECOAH5m]]
 
* [[RXN-14262]]
 
* [[RXN-7931]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
+
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
+
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
{{#set: molecular-weight=943.792}}
+
{{#set: molecular-weight=431.375}}

Revision as of 09:23, 27 August 2019

Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD

  • common-name:
    • pelargonidin-3-o-β-d-glucoside
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
  • inchi-key:
    • abvcubuixwjyse-gqupqbgvsa-m
  • molecular-weight:
    • 431.375

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality