Difference between revisions of "SJ02152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] == * common-name: ** porifersta-5,7-dienol * smiles: ** ccc(c(c)c)ccc(c)[c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** porifersta-5,7-dienol
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** wegxyvfdoluulo-tuumqracsa-n
+
** arvgmiswlzpbch-wgdhxtrrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 616.966
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13892]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=porifersta-5,7-dienol}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
+
{{#set: inchi-key=inchikey=arvgmiswlzpbch-wgdhxtrrsa-n}}
{{#set: molecular-weight=616.966}}
+
{{#set: molecular-weight=412.698}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-14900

  • common-name:
    • porifersta-5,7-dienol
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • arvgmiswlzpbch-wgdhxtrrsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality