Difference between revisions of "SJ11059"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=All-trans-Retinyl-Esters All-trans-Retinyl-Esters] == * common-name: ** an all-trans-retinyl es...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == * common-name: ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inosi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol |
| + | * smiles: | ||
| + | ** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) | ||
| + | * inchi-key: | ||
| + | ** hepuigaczyvucd-lfikjohqsa-o | ||
| + | * molecular-weight: | ||
| + | ** 342.322 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-121]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol}} |
| + | {{#set: inchi-key=inchikey=hepuigaczyvucd-lfikjohqsa-o}} | ||
| + | {{#set: molecular-weight=342.322}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD1G-0
- common-name:
- 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol
- smiles:
- c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
- inchi-key:
- hepuigaczyvucd-lfikjohqsa-o
- molecular-weight:
- 342.322
