Difference between revisions of "SJ16375"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-332 CPD1G-332] == * common-name: ** 2-carboxy-cerotoyl-coa * smiles: ** ccccccccccccccccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-332 CPD1G-332] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] ==
 
* common-name:
 
* common-name:
** 2-carboxy-cerotoyl-coa
+
** fmnh2
 
* smiles:
 
* smiles:
** ccccccccccccccccccccccccc(c([o-])=o)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3)))
 
* inchi-key:
 
* inchi-key:
** vuydekmwdhlssi-rvnpwdolsa-i
+
** ytnixzgthtvjbw-scrdcrapsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1185.185
+
** 456.348
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9510]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-4355]]
+
* [[RXN-9510]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxy-cerotoyl-coa}}
+
{{#set: common-name=fmnh2}}
{{#set: inchi-key=inchikey=vuydekmwdhlssi-rvnpwdolsa-i}}
+
{{#set: inchi-key=inchikey=ytnixzgthtvjbw-scrdcrapsa-l}}
{{#set: molecular-weight=1185.185}}
+
{{#set: molecular-weight=456.348}}

Revision as of 09:24, 27 August 2019

Metabolite FMNH2

  • common-name:
    • fmnh2
  • smiles:
    • cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3)))
  • inchi-key:
    • ytnixzgthtvjbw-scrdcrapsa-l
  • molecular-weight:
    • 456.348

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality