Difference between revisions of "SJ20515"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * common-name: ** melibiose * smiles: ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] ==
 
* common-name:
 
* common-name:
−
** malonyl-coa
+
** melibiose
 
* smiles:
 
* smiles:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o
 
* inchi-key:
 
* inchi-key:
−
** ltyoqgrjfjakna-dvvlenmvsa-i
+
** dlrvvldznnycbx-zzfzymbesa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 848.541
+
** 342.299
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[ALPHAGALACTOSID-RXN]]
−
* [[ACOACXr]]
 
−
* [[FATTY-ACID-SYNTHASE-RXN]]
 
−
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 
−
* [[RXN-10059]]
 
−
* [[RXN-10734]]
 
−
* [[RXN-12777]]
 
−
* [[RXN-13294]]
 
−
* [[RXN-13295]]
 
−
* [[RXN-13296]]
 
−
* [[RXN-13297]]
 
−
* [[RXN-13322]]
 
−
* [[RXN-13431]]
 
−
* [[RXN-13441]]
 
−
* [[RXN-14492]]
 
−
* [[RXN-16016]]
 
−
* [[RXN-16017]]
 
−
* [[RXN-16094]]
 
−
* [[RXN-16153]]
 
−
* [[RXN-3142]]
 
−
* [[RXN-7645]]
 
−
* [[RXN-7697]]
 
−
* [[RXN-9543]]
 
−
* [[RXN-9632]]
 
−
* [[RXN-9648]]
 
−
* [[RXN-9650]]
 
−
* [[RXN-9651]]
 
−
* [[RXN-9652]]
 
−
* [[RXN-9653]]
 
−
* [[RXN-9654]]
 
−
* [[RXN1G-368]]
 
−
* [[RXN1G-445]]
 
−
* [[RXN1G-499]]
 
−
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
−
* [[RXN0-5055]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=malonyl-coa}}
+
{{#set: common-name=melibiose}}
−
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
+
{{#set: inchi-key=inchikey=dlrvvldznnycbx-zzfzymbesa-n}}
−
{{#set: molecular-weight=848.541}}
+
{{#set: molecular-weight=342.299}}

Revision as of 09:24, 27 August 2019

Metabolite MELIBIOSE

  • common-name:
    • melibiose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o
  • inchi-key:
    • dlrvvldznnycbx-zzfzymbesa-n
  • molecular-weight:
    • 342.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ20515&oldid=27995"