Difference between revisions of "SJ09956"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ACETYLDIHYDROLIPOAMIDE S-ACETYLDIHYDROLIPOAMIDE] == * common-name: ** s-acetyldihydrolipoamid...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * i...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-citramalate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(o)(c(=o)[o-])cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xftrtwqbiomvpk-rxmqykedsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[R-2-METHYLMALATE-DEHYDRATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R-2-METHYLMALATE-DEHYDRATASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-citramalate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xftrtwqbiomvpk-rxmqykedsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-31
- common-name:
- (r)-citramalate
- smiles:
- cc(o)(c(=o)[o-])cc(=o)[o-]
- inchi-key:
- xftrtwqbiomvpk-rxmqykedsa-l
- molecular-weight:
- 146.099
