Difference between revisions of "PWY-702"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * common-name: ** ergosta-5,7,24(28)-trien-3β-ol * smiles: ** cc(c)c(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuron...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
 
* common-name:
 
* common-name:
** ergosta-5,7,24(28)-trien-3β-ol
+
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
 
* smiles:
 
* smiles:
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
* inchi-key:
** zepnvcgpjxyabb-loioqlkmsa-n
+
** yyfgggcinngole-zdxogfqlsa-m
 
* molecular-weight:
 
* molecular-weight:
** 396.655
+
** 826.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-707]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-218]]
+
* [[RXN-10607]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ergosta-5,7,24(28)-trien-3β-ol}}
+
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
{{#set: inchi-key=inchikey=zepnvcgpjxyabb-loioqlkmsa-n}}
+
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
{{#set: molecular-weight=396.655}}
+
{{#set: molecular-weight=826.095}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-11400

  • common-name:
    • 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
  • smiles:
    • c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
  • inchi-key:
    • yyfgggcinngole-zdxogfqlsa-m
  • molecular-weight:
    • 826.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality