Difference between revisions of "SJ07451"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-long-chain-fatty-acids Very-long-chain-fatty-acids] == * common-name: ** a very-long-chain...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-181 CPD-181] == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-181 CPD-181] == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-methylumbelliferyl acetate |
+ | * smiles: | ||
+ | ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) | ||
+ | * inchi-key: | ||
+ | ** hxvzgascdagaps-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 218.209 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.1.1.56-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-methylumbelliferyl acetate}} |
+ | {{#set: inchi-key=inchikey=hxvzgascdagaps-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=218.209}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-181
- common-name:
- 4-methylumbelliferyl acetate
- smiles:
- cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o)
- inchi-key:
- hxvzgascdagaps-uhfffaoysa-n
- molecular-weight:
- 218.209