Difference between revisions of "SJ20150"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9898 CPD-9898] == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * sm...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8773 CPD-8773] == * common-name: ** 4-methylbenzaldehyde * smiles: ** cc1(c=cc(c=o)=cc=1) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9898 CPD-9898] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8773 CPD-8773] ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
+
** 4-methylbenzaldehyde
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
+
** cc1(c=cc(c=o)=cc=1)
 
* inchi-key:
 
* inchi-key:
** fdppbyxdoxrdha-jsgwljpksa-m
+
** fxlovshxalflkq-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 780.205
+
** 120.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8582]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9281]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}}
+
{{#set: common-name=4-methylbenzaldehyde}}
{{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}}
+
{{#set: inchi-key=inchikey=fxlovshxalflkq-uhfffaoysa-n}}
{{#set: molecular-weight=780.205}}
+
{{#set: molecular-weight=120.151}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-8773

  • common-name:
    • 4-methylbenzaldehyde
  • smiles:
    • cc1(c=cc(c=o)=cc=1)
  • inchi-key:
    • fxlovshxalflkq-uhfffaoysa-n
  • molecular-weight:
    • 120.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality