Difference between revisions of "SJ08828"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] ==
 * common-name:
-** thiamine phosphate
+** l-valine
 * smiles:
-** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+** cc(c)c([n+])c([o-])=o
 * inchi-key:
-** hzsajdvwzrbgif-uhfffaoysa-m
+** kzsnjwfqevhdmf-bypyzucnsa-n
 * molecular-weight:
-** 343.317
+** 117.147
 == Reaction(s) known to consume the compound ==
-* [[RXN0-3542]]
+* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
+* [[RXN-16291]]
+* [[RXN-16294]]
+* [[RXN-16991]]
+* [[VALINE--TRNA-LIGASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-12610]]
+* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
-* [[RXN-12611]]
+* [[RXN-16294]]
-* [[RXN0-3542]]
-* [[THI-P-SYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=thiamine phosphate}}
+{{#set: common-name=l-valine}}
-{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=kzsnjwfqevhdmf-bypyzucnsa-n}}
-{{#set: molecular-weight=343.317}}
+{{#set: molecular-weight=117.147}}