Difference between revisions of "SJ22023"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10254 CPD-10254] == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unfolded-Proteins Unfolded-Proteins] == * common-name: ** an unfolded protein == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10254 CPD-10254] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unfolded-Proteins Unfolded-Proteins] ==
 
* common-name:
 
* common-name:
** (9z,12z)-hexadeca-9,12-dienoyl-coa
+
** an unfolded protein
* smiles:
 
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** cqxsjfxwargobe-pcrjdaltsa-j
 
* molecular-weight:
 
** 997.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-1061]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9616]]
+
* [[RXN0-1061]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
+
{{#set: common-name=an unfolded protein}}
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
 
{{#set: molecular-weight=997.883}}
 

Revision as of 09:24, 27 August 2019

Metabolite Unfolded-Proteins

  • common-name:
    • an unfolded protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality