Difference between revisions of "SJ07103"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * i...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(n=csc(ccop([o-])(=o)[o-])=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ocymerzcmyjqqo-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 221.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[THI-P-SYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[THIAZOLSYN3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=221.167}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite THZ-P
- common-name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- smiles:
- cc1(n=csc(ccop([o-])(=o)[o-])=1)
- inchi-key:
- ocymerzcmyjqqo-uhfffaoysa-l
- molecular-weight:
- 221.167
