Difference between revisions of "SJ07978"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturo...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO-tRNAs PRO-tRNAs] == * common-name: ** a trnapro == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO-tRNAs PRO-tRNAs] ==
 
* common-name:
 
* common-name:
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
+
** a trnapro
* smiles:
 
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
 
* inchi-key:
 
** llvvmxfnkahvez-gawnparcsa-l
 
* molecular-weight:
 
** 350.235
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14897]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
+
{{#set: common-name=a trnapro}}
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
 
{{#set: molecular-weight=350.235}}
 

Revision as of 09:24, 27 August 2019

Metabolite PRO-tRNAs

  • common-name:
    • a trnapro

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality