Difference between revisions of "SJ07344"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15035 CPD-15035] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15035 CPD-15035] == |
* common-name: | * common-name: | ||
− | ** 2- | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine |
* smiles: | * smiles: | ||
− | ** cc(= | + | ** cc(=o)nc2(c(oc1(oc(c(=o)[o-])=cc(o)c(os([o-])(=o)=o)1))c(o)c(co)oc(o)2) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zeucjyoqjtzlfj-rbcdgzsosa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 457.362 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14021]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2- | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zeucjyoqjtzlfj-rbcdgzsosa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=457.362}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-15035
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine
- smiles:
- cc(=o)nc2(c(oc1(oc(c(=o)[o-])=cc(o)c(os([o-])(=o)=o)1))c(o)c(co)oc(o)2)
- inchi-key:
- zeucjyoqjtzlfj-rbcdgzsosa-l
- molecular-weight:
- 457.362