Difference between revisions of "SJ21022"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] ==
 * common-name:
-** 2-protocatechuoylphloroglucinolcarboxylate
+** palmitoleate
 * smiles:
-** c(c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(=c(c=2)o)o))=o))([o-])=o
+** ccccccc=ccccccccc(=o)[o-]
 * inchi-key:
-** grxielrcpyieqi-uhfffaoysa-m
+** secpzkhbenqxjg-fplpwbnlsa-m
 * molecular-weight:
-** 305.22
+** 253.404
 == Reaction(s) known to consume the compound ==
+* [[RXN0-7248]]
 == Reaction(s) known to produce the compound ==
-* [[QUERCETIN-23-DIOXYGENASE-RXN]]
+* [[RXN-10662]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-protocatechuoylphloroglucinolcarboxylate}}
+{{#set: common-name=palmitoleate}}
-{{#set: inchi-key=inchikey=grxielrcpyieqi-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}}
-{{#set: molecular-weight=305.22}}
+{{#set: molecular-weight=253.404}}