Difference between revisions of "SJ10684"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13665 CPD-13665] == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == * common-name: ** 3-hydroxy-l-kynurenine * sm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hydroxy-l-kynurenine |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vckpuufaignjhc-lurjtmiesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 224.216 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10721]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
| + | * [[RXN-10721]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-l-kynurenine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.216}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite 3-HYDROXY-L-KYNURENINE
- common-name:
- 3-hydroxy-l-kynurenine
- smiles:
- c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
- inchi-key:
- vckpuufaignjhc-lurjtmiesa-n
- molecular-weight:
- 224.216
