Difference between revisions of "SJ19490"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOMASS BIOMASS] == == Reaction(s) known to consume the compound == * Exchange_BIOMASS * ...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * common-name: ** trans-δ2, cis-δ4-de...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOMASS BIOMASS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] ==
 +
* common-name:
 +
** trans-δ2, cis-δ4-decadienoyl-coa
 +
* smiles:
 +
** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** fasakylwsrdqoh-imvfqkdnsa-j
 +
* molecular-weight:
 +
** 913.722
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[Exchange_BIOMASS]]
+
* [[DIENOYLCOAREDUCT-RXN]]
* [[Transport_BIOMASS]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[Exchange_BIOMASS]]
 
* [[Transport_BIOMASS]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}}
 +
{{#set: molecular-weight=913.722}}

Revision as of 09:24, 27 August 2019

Metabolite T2-C4-DECADIENYL-COA

  • common-name:
    • trans-δ2, cis-δ4-decadienoyl-coa
  • smiles:
    • cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fasakylwsrdqoh-imvfqkdnsa-j
  • molecular-weight:
    • 913.722

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality