Difference between revisions of "SJ19490"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOMASS BIOMASS] == == Reaction(s) known to consume the compound == * Exchange_BIOMASS * ...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * common-name: ** trans-δ2, cis-δ4-de...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == |
+ | * common-name: | ||
+ | ** trans-δ2, cis-δ4-decadienoyl-coa | ||
+ | * smiles: | ||
+ | ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** fasakylwsrdqoh-imvfqkdnsa-j | ||
+ | * molecular-weight: | ||
+ | ** 913.722 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIENOYLCOAREDUCT-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}} | ||
+ | {{#set: molecular-weight=913.722}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite T2-C4-DECADIENYL-COA
- common-name:
- trans-δ2, cis-δ4-decadienoyl-coa
- smiles:
- cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- fasakylwsrdqoh-imvfqkdnsa-j
- molecular-weight:
- 913.722